C17H19N5O3 — CID 6418887
N-(5,6-dimethyl-1,2,4-triazin-3-yl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)propanamide (PubChem CID 6418887) has the molecular formula C17H19N5O3 and a molecular weight of 341.37 g/mol. Its IUPAC name is N-(5,6-dimethyl-1,2,4-triazin-3-yl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)propanamide.
| Compound Name | N-(5,6-dimethyl-1,2,4-triazin-3-yl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)propanamide |
|---|---|
| PubChem CID | 6418887 |
| Molecular Formula | C17H19N5O3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | N-(5,6-dimethyl-1,2,4-triazin-3-yl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)propanamide |
| SMILES | Cc1nnc(NC(=O)CCN2C(=O)C3C4C=CC(C4)C3C2=O)nc1C |
| InChI | InChI=1S/C17H19N5O3/c1-8-9(2)20-21-17(18-8)19-12(23)5-6-22-15(24)13-10-3-4-11(7-10)14(13)16(22)25/h3-4,10-11,13-14H,5-7H2,1-2H3,(H,18,19,21,23) |
| InChIKey | ZMXMOJUDSYZXJP-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|