C16H12N6OS — CID 6419287
4-[5-(furan-2-yl)-1H-pyrazol-3-yl]-11,12-dimethyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 6419287) has the molecular formula C16H12N6OS and a molecular weight of 336.38 g/mol. Its IUPAC name is 4-[5-(furan-2-yl)-1H-pyrazol-3-yl]-11,12-dimethyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 4-[5-(furan-2-yl)-1H-pyrazol-3-yl]-11,12-dimethyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 6419287 |
| Molecular Formula | C16H12N6OS |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 4-[5-(furan-2-yl)-1H-pyrazol-3-yl]-11,12-dimethyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | Cc1sc2ncn3nc(-c4cc(-c5ccco5)[nH]n4)nc3c2c1C |
| InChI | InChI=1S/C16H12N6OS/c1-8-9(2)24-16-13(8)15-18-14(21-22(15)7-17-16)11-6-10(19-20-11)12-4-3-5-23-12/h3-7H,1-2H3,(H,19,20) |
| InChIKey | DSRDJKWBRLFGSA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 84.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |