C20H14Cl2N4 — CID 6419392
N-(3,4-dichlorophenyl)-4-(pyridin-4-ylmethyl)phthalazin-1-amine (PubChem CID 6419392) has the molecular formula C20H14Cl2N4 and a molecular weight of 381.27 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-4-(pyridin-4-ylmethyl)phthalazin-1-amine.
| Compound Name | N-(3,4-dichlorophenyl)-4-(pyridin-4-ylmethyl)phthalazin-1-amine |
|---|---|
| PubChem CID | 6419392 |
| Molecular Formula | C20H14Cl2N4 |
| Molecular Weight | 381.27 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | N-(3,4-dichlorophenyl)-4-(pyridin-4-ylmethyl)phthalazin-1-amine |
| SMILES | Clc1ccc(Nc2nnc(Cc3ccncc3)c3ccccc23)cc1Cl |
| InChI | InChI=1S/C20H14Cl2N4/c21-17-6-5-14(12-18(17)22)24-20-16-4-2-1-3-15(16)19(25-26-20)11-13-7-9-23-10-8-13/h1-10,12H,11H2,(H,24,26) |
| InChIKey | UIFQBRNVJVUAKO-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.27 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |