C21H14BrF3N4 — CID 6419396
N-[3-bromo-5-(trifluoromethyl)phenyl]-4-(pyridin-4-ylmethyl)phthalazin-1-amine (PubChem CID 6419396) has the molecular formula C21H14BrF3N4 and a molecular weight of 459.27 g/mol. Its IUPAC name is N-[3-bromo-5-(trifluoromethyl)phenyl]-4-(pyridin-4-ylmethyl)phthalazin-1-amine.
| Compound Name | N-[3-bromo-5-(trifluoromethyl)phenyl]-4-(pyridin-4-ylmethyl)phthalazin-1-amine |
|---|---|
| PubChem CID | 6419396 |
| Molecular Formula | C21H14BrF3N4 |
| Molecular Weight | 459.27 g/mol |
| Exact Mass | 458.04 |
| IUPAC Name | N-[3-bromo-5-(trifluoromethyl)phenyl]-4-(pyridin-4-ylmethyl)phthalazin-1-amine |
| SMILES | FC(F)(F)c1cc(Br)cc(Nc2nnc(Cc3ccncc3)c3ccccc23)c1 |
| InChI | InChI=1S/C21H14BrF3N4/c22-15-10-14(21(23,24)25)11-16(12-15)27-20-18-4-2-1-3-17(18)19(28-29-20)9-13-5-7-26-8-6-13/h1-8,10-12H,9H2,(H,27,29) |
| InChIKey | BZGHPHUNZKSCKZ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.27 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |