C16H25NO5S — CID 6419632
(3S,7E,9R,13R)-9,13-dimethyl-3-(2-methylsulfanylethyl)-1,11-dioxa-4-azacyclotetradec-7-ene-2,5,12-trione (PubChem CID 6419632) has the molecular formula C16H25NO5S and a molecular weight of 343.45 g/mol. Its IUPAC name is (3S,7E,9R,13R)-9,13-dimethyl-3-(2-methylsulfanylethyl)-1,11-dioxa-4-azacyclotetradec-7-ene-2,5,12-trione.
| Compound Name | (3S,7E,9R,13R)-9,13-dimethyl-3-(2-methylsulfanylethyl)-1,11-dioxa-4-azacyclotetradec-7-ene-2,5,12-trione |
|---|---|
| PubChem CID | 6419632 |
| Molecular Formula | C16H25NO5S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | (3S,7E,9R,13R)-9,13-dimethyl-3-(2-methylsulfanylethyl)-1,11-dioxa-4-azacyclotetradec-7-ene-2,5,12-trione |
| SMILES | CSCC[C@@H]1NC(=O)C/C=C/[C@@H](C)COC(=O)[C@H](C)COC1=O |
| InChI | InChI=1S/C16H25NO5S/c1-11-5-4-6-14(18)17-13(7-8-23-3)16(20)22-10-12(2)15(19)21-9-11/h4-5,11-13H,6-10H2,1-3H3,(H,17,18)/b5-4+/t11-,12-,13+/m1/s1 |
| InChIKey | JCMPDFWMPUSKDF-MTTQNTSXSA-N |
| XLogP | 1.54 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|