About 2-oxohexanoate
2-oxohexanoate (PubChem CID 6419709) has the molecular formula C6H9O3-
and a molecular weight of 129.13 g/mol. Its IUPAC name is 2-oxohexanoate.
Molecular Properties
| Compound Name | 2-oxohexanoate |
| PubChem CID | 6419709 |
| Molecular Formula | C6H9O3- |
| Molecular Weight | 129.13 g/mol |
| Exact Mass | 129.06 |
| IUPAC Name | 2-oxohexanoate |
| SMILES | CCCCC(=O)C(=O)[O-] |
| InChI | InChI=1S/C6H10O3/c1-2-3-4-5(7)6(8)9/h2-4H2,1H3,(H,8,9)/p-1 |
| InChIKey | XNIHZNNZJHYHLC-UHFFFAOYSA-M |
| XLogP | -0.50 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.13 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-oxohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxohexanoate?
The IUPAC name of 2-oxohexanoate (CID 6419709) is 2-oxohexanoate.
What is the SMILES notation for 2-oxohexanoate?
The canonical SMILES for 2-oxohexanoate is CCCCC(=O)C(=O)[O-].
What is the InChIKey of 2-oxohexanoate?
The InChIKey is XNIHZNNZJHYHLC-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H10O3/c1-2-3-4-5(7)6(8)9/h2-4H2,1H3,(H,8,9)/p-1.
What are the key properties of 2-oxohexanoate?
2-oxohexanoate has a molecular weight of 129.13 g/mol, XLogP of -0.50, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxohexanoate is sourced from PubChem (CID 6419709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).