About 3-(3-chlorophenyl)-N-(2-pyridin-2-ylethyl)imidazo[1,2-b]pyridazin-6-amine
3-(3-chlorophenyl)-N-(2-pyridin-2-ylethyl)imidazo[1,2-b]pyridazin-6-amine (PubChem CID 6419826) has the molecular formula C19H16ClN5
and a molecular weight of 349.83 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-N-(2-pyridin-2-ylethyl)imidazo[1,2-b]pyridazin-6-amine.
Molecular Properties
| Compound Name | 3-(3-chlorophenyl)-N-(2-pyridin-2-ylethyl)imidazo[1,2-b]pyridazin-6-amine |
| PubChem CID | 6419826 |
| Molecular Formula | C19H16ClN5 |
| Molecular Weight | 349.83 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 3-(3-chlorophenyl)-N-(2-pyridin-2-ylethyl)imidazo[1,2-b]pyridazin-6-amine |
| SMILES | Clc1cccc(-c2cnc3ccc(NCCc4ccccn4)nn23)c1 |
| InChI | InChI=1S/C19H16ClN5/c20-15-5-3-4-14(12-15)17-13-23-19-8-7-18(24-25(17)19)22-11-9-16-6-1-2-10-21-16/h1-8,10,12-13H,9,11H2,(H,22,24) |
| InChIKey | VWHUGDIGTGOTHL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.83 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(3-chlorophenyl)-N-(2-pyridin-2-ylethyl)imidazo[1,2-b]pyridazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-chlorophenyl)-N-(2-pyridin-2-ylethyl)imidazo[1,2-b]pyridazin-6-amine?
The IUPAC name of 3-(3-chlorophenyl)-N-(2-pyridin-2-ylethyl)imidazo[1,2-b]pyridazin-6-amine (CID 6419826) is 3-(3-chlorophenyl)-N-(2-pyridin-2-ylethyl)imidazo[1,2-b]pyridazin-6-amine.
What is the SMILES notation for 3-(3-chlorophenyl)-N-(2-pyridin-2-ylethyl)imidazo[1,2-b]pyridazin-6-amine?
The canonical SMILES for 3-(3-chlorophenyl)-N-(2-pyridin-2-ylethyl)imidazo[1,2-b]pyridazin-6-amine is Clc1cccc(-c2cnc3ccc(NCCc4ccccn4)nn23)c1.
What is the InChIKey of 3-(3-chlorophenyl)-N-(2-pyridin-2-ylethyl)imidazo[1,2-b]pyridazin-6-amine?
The InChIKey is VWHUGDIGTGOTHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16ClN5/c20-15-5-3-4-14(12-15)17-13-23-19-8-7-18(24-25(17)19)22-11-9-16-6-1-2-10-21-16/h1-8,10,12-13H,9,11H2,(H,22,24).
What are the key properties of 3-(3-chlorophenyl)-N-(2-pyridin-2-ylethyl)imidazo[1,2-b]pyridazin-6-amine?
3-(3-chlorophenyl)-N-(2-pyridin-2-ylethyl)imidazo[1,2-b]pyridazin-6-amine has a molecular weight of 349.83 g/mol, XLogP of 4.10, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-chlorophenyl)-N-(2-pyridin-2-ylethyl)imidazo[1,2-b]pyridazin-6-amine is sourced from PubChem (CID 6419826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).