C10H13NO — CID 6420130
(1S,2S)-2-amino-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 6420130) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is (1S,2S)-2-amino-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | (1S,2S)-2-amino-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 6420130 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | (1S,2S)-2-amino-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | N[C@H]1CCc2ccccc2[C@@H]1O |
| InChI | InChI=1S/C10H13NO/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-4,9-10,12H,5-6,11H2/t9-,10-/m0/s1 |
| InChIKey | IIMSEFZOOYSTDO-UWVGGRQHSA-N |
| XLogP | 0.99 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |