C3F9N5 — CID 6420222
N'-[2,3-bis(difluoroamino)-2,3-difluoroaziridin-1-yl]-N,N-difluorocarbamimidoyl fluoride (PubChem CID 6420222) has the molecular formula C3F9N5 and a molecular weight of 277.05 g/mol. Its IUPAC name is N'-[2,3-bis(difluoroamino)-2,3-difluoroaziridin-1-yl]-N,N-difluorocarbamimidoyl fluoride.
| Compound Name | N'-[2,3-bis(difluoroamino)-2,3-difluoroaziridin-1-yl]-N,N-difluorocarbamimidoyl fluoride |
|---|---|
| PubChem CID | 6420222 |
| Molecular Formula | C3F9N5 |
| Molecular Weight | 277.05 g/mol |
| Exact Mass | 277.00 |
| IUPAC Name | N'-[2,3-bis(difluoroamino)-2,3-difluoroaziridin-1-yl]-N,N-difluorocarbamimidoyl fluoride |
| SMILES | F/C(=N/N1C(F)(N(F)F)C1(F)N(F)F)N(F)F |
| InChI | InChI=1S/C3F9N5/c4-1(14(7)8)13-15-2(5,16(9)10)3(15,6)17(11)12/b13-1- |
| InChIKey | WKCYZSJHVGYLIC-ATVWYZQASA-N |
| XLogP | 2.00 |
| TPSA | 25.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.05 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|