About prop-2-enyl propyl carbonate
prop-2-enyl propyl carbonate (PubChem CID 6420256) has the molecular formula C7H12O3
and a molecular weight of 144.17 g/mol. Its IUPAC name is prop-2-enyl propyl carbonate.
Molecular Properties
| Compound Name | prop-2-enyl propyl carbonate |
| PubChem CID | 6420256 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | prop-2-enyl propyl carbonate |
| SMILES | C=CCOC(=O)OCCC |
| InChI | InChI=1S/C7H12O3/c1-3-5-9-7(8)10-6-4-2/h3H,1,4-6H2,2H3 |
| InChIKey | QWNFSVYIPSLJNZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl propyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl propyl carbonate?
The IUPAC name of prop-2-enyl propyl carbonate (CID 6420256) is prop-2-enyl propyl carbonate.
What is the SMILES notation for prop-2-enyl propyl carbonate?
The canonical SMILES for prop-2-enyl propyl carbonate is C=CCOC(=O)OCCC.
What is the InChIKey of prop-2-enyl propyl carbonate?
The InChIKey is QWNFSVYIPSLJNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3/c1-3-5-9-7(8)10-6-4-2/h3H,1,4-6H2,2H3.
What are the key properties of prop-2-enyl propyl carbonate?
prop-2-enyl propyl carbonate has a molecular weight of 144.17 g/mol, XLogP of 1.74, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl propyl carbonate is sourced from PubChem (CID 6420256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).