About 4-amino-2,2,6,6-tetramethylpiperidine-4-carbonitrile
4-amino-2,2,6,6-tetramethylpiperidine-4-carbonitrile (PubChem CID 6420305) has the molecular formula C10H19N3
and a molecular weight of 181.28 g/mol. Its IUPAC name is 4-amino-2,2,6,6-tetramethylpiperidine-4-carbonitrile.
Analyze 4-amino-2,2,6,6-tetramethylpiperidine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2,2,6,6-tetramethylpiperidine-4-carbonitrile?
The IUPAC name of 4-amino-2,2,6,6-tetramethylpiperidine-4-carbonitrile (CID 6420305) is 4-amino-2,2,6,6-tetramethylpiperidine-4-carbonitrile.
What is the SMILES notation for 4-amino-2,2,6,6-tetramethylpiperidine-4-carbonitrile?
The canonical SMILES for 4-amino-2,2,6,6-tetramethylpiperidine-4-carbonitrile is CC1(C)CC(N)(C#N)CC(C)(C)N1.
What is the InChIKey of 4-amino-2,2,6,6-tetramethylpiperidine-4-carbonitrile?
The InChIKey is TUQXWQZFCWHWQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3/c1-8(2)5-10(12,7-11)6-9(3,4)13-8/h13H,5-6,12H2,1-4H3.
What are the key properties of 4-amino-2,2,6,6-tetramethylpiperidine-4-carbonitrile?
4-amino-2,2,6,6-tetramethylpiperidine-4-carbonitrile has a molecular weight of 181.28 g/mol, XLogP of 1.15, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2,2,6,6-tetramethylpiperidine-4-carbonitrile is sourced from PubChem (CID 6420305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).