(Z)-2,3-dichlorobut-2-enoic acid

C4H4Cl2O2 — CID 642037

IUPAC(Z)-2,3-dichlorobut-2-enoic acid
SMILESC/C(Cl)=C(/Cl)C(=O)O
InChIInChI=1S/C4H4Cl2O2/c1-2(5)3(6)4(7)8/h1H3,(H,7,8)/b3-2-
InChIKeySPGUWQVKUFZXJJ-IHWYPQMZSA-N
MW154.98 g/mol
LogP1.78
Rot. Bonds1

About (Z)-2,3-dichlorobut-2-enoic acid

(Z)-2,3-dichlorobut-2-enoic acid (PubChem CID 642037) has the molecular formula C4H4Cl2O2 and a molecular weight of 154.98 g/mol. Its IUPAC name is (Z)-2,3-dichlorobut-2-enoic acid.

Molecular Properties

Compound Name(Z)-2,3-dichlorobut-2-enoic acid
PubChem CID642037
Molecular FormulaC4H4Cl2O2
Molecular Weight154.98 g/mol
Exact Mass153.96
IUPAC Name(Z)-2,3-dichlorobut-2-enoic acid
SMILESC/C(Cl)=C(/Cl)C(=O)O
InChIInChI=1S/C4H4Cl2O2/c1-2(5)3(6)4(7)8/h1H3,(H,7,8)/b3-2-
InChIKeySPGUWQVKUFZXJJ-IHWYPQMZSA-N
XLogP1.78
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500154.98
LogP ≤ 51.78
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (Z)-2,3-dichlorobut-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z)-2,3-dichlorobut-2-enoic acid?
The IUPAC name of (Z)-2,3-dichlorobut-2-enoic acid (CID 642037) is (Z)-2,3-dichlorobut-2-enoic acid.
What is the SMILES notation for (Z)-2,3-dichlorobut-2-enoic acid?
The canonical SMILES for (Z)-2,3-dichlorobut-2-enoic acid is C/C(Cl)=C(/Cl)C(=O)O.
What is the InChIKey of (Z)-2,3-dichlorobut-2-enoic acid?
The InChIKey is SPGUWQVKUFZXJJ-IHWYPQMZSA-N. The full InChI is InChI=1S/C4H4Cl2O2/c1-2(5)3(6)4(7)8/h1H3,(H,7,8)/b3-2-.
What are the key properties of (Z)-2,3-dichlorobut-2-enoic acid?
(Z)-2,3-dichlorobut-2-enoic acid has a molecular weight of 154.98 g/mol, XLogP of 1.78, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2,3-dichlorobut-2-enoic acid is sourced from PubChem (CID 642037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).