C16H30O2 — CID 6420609
8-(2-hydroxyethyl)-4,4,7,8-tetramethyl-1,2,3,4a,5,6,7,8a-octahydronaphthalen-1-ol (PubChem CID 6420609) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is 8-(2-hydroxyethyl)-4,4,7,8-tetramethyl-1,2,3,4a,5,6,7,8a-octahydronaphthalen-1-ol.
| Compound Name | 8-(2-hydroxyethyl)-4,4,7,8-tetramethyl-1,2,3,4a,5,6,7,8a-octahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 6420609 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | 8-(2-hydroxyethyl)-4,4,7,8-tetramethyl-1,2,3,4a,5,6,7,8a-octahydronaphthalen-1-ol |
| SMILES | CC1CCC2C(C(O)CCC2(C)C)C1(C)CCO |
| InChI | InChI=1S/C16H30O2/c1-11-5-6-12-14(16(11,4)9-10-17)13(18)7-8-15(12,2)3/h11-14,17-18H,5-10H2,1-4H3 |
| InChIKey | QZLGFTBIUCLIBR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |