About butyl undec-10-enyl carbonate
butyl undec-10-enyl carbonate (PubChem CID 6420629) has the molecular formula C16H30O3
and a molecular weight of 270.41 g/mol. Its IUPAC name is butyl undec-10-enyl carbonate.
Molecular Properties
| Compound Name | butyl undec-10-enyl carbonate |
| PubChem CID | 6420629 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | butyl undec-10-enyl carbonate |
| SMILES | C=CCCCCCCCCCOC(=O)OCCCC |
| InChI | InChI=1S/C16H30O3/c1-3-5-7-8-9-10-11-12-13-15-19-16(17)18-14-6-4-2/h3H,1,4-15H2,2H3 |
| InChIKey | YOKOIYLOCVXIDR-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze butyl undec-10-enyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl undec-10-enyl carbonate?
The IUPAC name of butyl undec-10-enyl carbonate (CID 6420629) is butyl undec-10-enyl carbonate.
What is the SMILES notation for butyl undec-10-enyl carbonate?
The canonical SMILES for butyl undec-10-enyl carbonate is C=CCCCCCCCCCOC(=O)OCCCC.
What is the InChIKey of butyl undec-10-enyl carbonate?
The InChIKey is YOKOIYLOCVXIDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O3/c1-3-5-7-8-9-10-11-12-13-15-19-16(17)18-14-6-4-2/h3H,1,4-15H2,2H3.
What are the key properties of butyl undec-10-enyl carbonate?
butyl undec-10-enyl carbonate has a molecular weight of 270.41 g/mol, XLogP of 5.25, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl undec-10-enyl carbonate is sourced from PubChem (CID 6420629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).