C9H17N2O2+ — CID 6420653
N-(2,2,6,6-tetramethyl-1-oxopiperidin-1-ium-4-ylidene)hydroxylamine (PubChem CID 6420653) has the molecular formula C9H17N2O2+ and a molecular weight of 185.25 g/mol. Its IUPAC name is N-(2,2,6,6-tetramethyl-1-oxopiperidin-1-ium-4-ylidene)hydroxylamine.
| Compound Name | N-(2,2,6,6-tetramethyl-1-oxopiperidin-1-ium-4-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 6420653 |
| Molecular Formula | C9H17N2O2+ |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.13 |
| IUPAC Name | N-(2,2,6,6-tetramethyl-1-oxopiperidin-1-ium-4-ylidene)hydroxylamine |
| SMILES | CC1(C)CC(=NO)CC(C)(C)[N+]1=O |
| InChI | InChI=1S/C9H16N2O2/c1-8(2)5-7(10-12)6-9(3,4)11(8)13/h5-6H2,1-4H3/p+1 |
| InChIKey | OVAFKYQMGBXYKN-UHFFFAOYSA-O |
| XLogP | 1.95 |
| TPSA | 52.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|