C9H14F7O2P — CID 6420673
1-[ethyl(1,1,2,2,3,3,3-heptafluoropropyl)phosphoryl]oxy-2-methylpropane (PubChem CID 6420673) has the molecular formula C9H14F7O2P and a molecular weight of 318.17 g/mol. Its IUPAC name is 1-[ethyl(1,1,2,2,3,3,3-heptafluoropropyl)phosphoryl]oxy-2-methylpropane.
| Compound Name | 1-[ethyl(1,1,2,2,3,3,3-heptafluoropropyl)phosphoryl]oxy-2-methylpropane |
|---|---|
| PubChem CID | 6420673 |
| Molecular Formula | C9H14F7O2P |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 1-[ethyl(1,1,2,2,3,3,3-heptafluoropropyl)phosphoryl]oxy-2-methylpropane |
| SMILES | CCP(=O)(OCC(C)C)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H14F7O2P/c1-4-19(17,18-5-6(2)3)9(15,16)7(10,11)8(12,13)14/h6H,4-5H2,1-3H3 |
| InChIKey | KJBHBYJKALDOQV-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|