About 4-methylpentyl 2-methylpropyl carbonate
4-methylpentyl 2-methylpropyl carbonate (PubChem CID 6420716) has the molecular formula C11H22O3
and a molecular weight of 202.29 g/mol. Its IUPAC name is 4-methylpentyl 2-methylpropyl carbonate.
Molecular Properties
| Compound Name | 4-methylpentyl 2-methylpropyl carbonate |
| PubChem CID | 6420716 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | 4-methylpentyl 2-methylpropyl carbonate |
| SMILES | CC(C)CCCOC(=O)OCC(C)C |
| InChI | InChI=1S/C11H22O3/c1-9(2)6-5-7-13-11(12)14-8-10(3)4/h9-10H,5-8H2,1-4H3 |
| InChIKey | ZMJSSYOUAJNOPZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-methylpentyl 2-methylpropyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpentyl 2-methylpropyl carbonate?
The IUPAC name of 4-methylpentyl 2-methylpropyl carbonate (CID 6420716) is 4-methylpentyl 2-methylpropyl carbonate.
What is the SMILES notation for 4-methylpentyl 2-methylpropyl carbonate?
The canonical SMILES for 4-methylpentyl 2-methylpropyl carbonate is CC(C)CCCOC(=O)OCC(C)C.
What is the InChIKey of 4-methylpentyl 2-methylpropyl carbonate?
The InChIKey is ZMJSSYOUAJNOPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O3/c1-9(2)6-5-7-13-11(12)14-8-10(3)4/h9-10H,5-8H2,1-4H3.
What are the key properties of 4-methylpentyl 2-methylpropyl carbonate?
4-methylpentyl 2-methylpropyl carbonate has a molecular weight of 202.29 g/mol, XLogP of 3.23, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpentyl 2-methylpropyl carbonate is sourced from PubChem (CID 6420716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).