About 6,7-dimethyl-1,4-dithia-8-azaspiro[4.5]decane
6,7-dimethyl-1,4-dithia-8-azaspiro[4.5]decane (PubChem CID 6420750) has the molecular formula C9H17NS2
and a molecular weight of 203.38 g/mol. Its IUPAC name is 6,7-dimethyl-1,4-dithia-8-azaspiro[4.5]decane.
Molecular Properties
| Compound Name | 6,7-dimethyl-1,4-dithia-8-azaspiro[4.5]decane |
| PubChem CID | 6420750 |
| Molecular Formula | C9H17NS2 |
| Molecular Weight | 203.38 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 6,7-dimethyl-1,4-dithia-8-azaspiro[4.5]decane |
| SMILES | CC1NCCC2(SCCS2)C1C |
| InChI | InChI=1S/C9H17NS2/c1-7-8(2)10-4-3-9(7)11-5-6-12-9/h7-8,10H,3-6H2,1-2H3 |
| InChIKey | KXEIVFQIECTMNP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,7-dimethyl-1,4-dithia-8-azaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethyl-1,4-dithia-8-azaspiro[4.5]decane?
The IUPAC name of 6,7-dimethyl-1,4-dithia-8-azaspiro[4.5]decane (CID 6420750) is 6,7-dimethyl-1,4-dithia-8-azaspiro[4.5]decane.
What is the SMILES notation for 6,7-dimethyl-1,4-dithia-8-azaspiro[4.5]decane?
The canonical SMILES for 6,7-dimethyl-1,4-dithia-8-azaspiro[4.5]decane is CC1NCCC2(SCCS2)C1C.
What is the InChIKey of 6,7-dimethyl-1,4-dithia-8-azaspiro[4.5]decane?
The InChIKey is KXEIVFQIECTMNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NS2/c1-7-8(2)10-4-3-9(7)11-5-6-12-9/h7-8,10H,3-6H2,1-2H3.
What are the key properties of 6,7-dimethyl-1,4-dithia-8-azaspiro[4.5]decane?
6,7-dimethyl-1,4-dithia-8-azaspiro[4.5]decane has a molecular weight of 203.38 g/mol, XLogP of 2.18, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethyl-1,4-dithia-8-azaspiro[4.5]decane is sourced from PubChem (CID 6420750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).