C19H36N2 — CID 6420915
2,2,6,6-tetramethyl-N-[2-(2,2,3-trimethylcyclopent-3-en-1-yl)ethyl]piperidin-4-amine (PubChem CID 6420915) has the molecular formula C19H36N2 and a molecular weight of 292.51 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-N-[2-(2,2,3-trimethylcyclopent-3-en-1-yl)ethyl]piperidin-4-amine.
| Compound Name | 2,2,6,6-tetramethyl-N-[2-(2,2,3-trimethylcyclopent-3-en-1-yl)ethyl]piperidin-4-amine |
|---|---|
| PubChem CID | 6420915 |
| Molecular Formula | C19H36N2 |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.29 |
| IUPAC Name | 2,2,6,6-tetramethyl-N-[2-(2,2,3-trimethylcyclopent-3-en-1-yl)ethyl]piperidin-4-amine |
| SMILES | CC1=CCC(CCNC2CC(C)(C)NC(C)(C)C2)C1(C)C |
| InChI | InChI=1S/C19H36N2/c1-14-8-9-15(19(14,6)7)10-11-20-16-12-17(2,3)21-18(4,5)13-16/h8,15-16,20-21H,9-13H2,1-7H3 |
| InChIKey | DPHRUKAMMQMTOZ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|