About 1-butyl-3,4-dihydroxypyrrolidine-2,5-dione
1-butyl-3,4-dihydroxypyrrolidine-2,5-dione (PubChem CID 6420934) has the molecular formula C8H13NO4
and a molecular weight of 187.19 g/mol. Its IUPAC name is 1-butyl-3,4-dihydroxypyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | 1-butyl-3,4-dihydroxypyrrolidine-2,5-dione |
| PubChem CID | 6420934 |
| Molecular Formula | C8H13NO4 |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 1-butyl-3,4-dihydroxypyrrolidine-2,5-dione |
| SMILES | CCCCN1C(=O)C(O)C(O)C1=O |
| InChI | InChI=1S/C8H13NO4/c1-2-3-4-9-7(12)5(10)6(11)8(9)13/h5-6,10-11H,2-4H2,1H3 |
| InChIKey | WSRKOIRZUJKVLL-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3,4-dihydroxypyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3,4-dihydroxypyrrolidine-2,5-dione?
The IUPAC name of 1-butyl-3,4-dihydroxypyrrolidine-2,5-dione (CID 6420934) is 1-butyl-3,4-dihydroxypyrrolidine-2,5-dione.
What is the SMILES notation for 1-butyl-3,4-dihydroxypyrrolidine-2,5-dione?
The canonical SMILES for 1-butyl-3,4-dihydroxypyrrolidine-2,5-dione is CCCCN1C(=O)C(O)C(O)C1=O.
What is the InChIKey of 1-butyl-3,4-dihydroxypyrrolidine-2,5-dione?
The InChIKey is WSRKOIRZUJKVLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO4/c1-2-3-4-9-7(12)5(10)6(11)8(9)13/h5-6,10-11H,2-4H2,1H3.
What are the key properties of 1-butyl-3,4-dihydroxypyrrolidine-2,5-dione?
1-butyl-3,4-dihydroxypyrrolidine-2,5-dione has a molecular weight of 187.19 g/mol, XLogP of -1.12, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3,4-dihydroxypyrrolidine-2,5-dione is sourced from PubChem (CID 6420934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).