C47H24F24OP2 — CID 6421024
[5-bis[3,5-bis(trifluoromethyl)phenyl]phosphanyl-9,9-dimethylxanthen-4-yl]-bis[3,5-bis(trifluoromethyl)phenyl]phosphane (PubChem CID 6421024) has the molecular formula C47H24F24OP2 and a molecular weight of 1122.61 g/mol. Its IUPAC name is [5-bis[3,5-bis(trifluoromethyl)phenyl]phosphanyl-9,9-dimethylxanthen-4-yl]-bis[3,5-bis(trifluoromethyl)phenyl]phosphane.
| Compound Name | [5-bis[3,5-bis(trifluoromethyl)phenyl]phosphanyl-9,9-dimethylxanthen-4-yl]-bis[3,5-bis(trifluoromethyl)phenyl]phosphane |
|---|---|
| PubChem CID | 6421024 |
| Molecular Formula | C47H24F24OP2 |
| Molecular Weight | 1122.61 g/mol |
| Exact Mass | 1122.09 |
| IUPAC Name | [5-bis[3,5-bis(trifluoromethyl)phenyl]phosphanyl-9,9-dimethylxanthen-4-yl]-bis[3,5-bis(trifluoromethyl)phenyl]phosphane |
| SMILES | CC1(C)c2cccc(P(c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c2Oc2c(P(c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)cccc21 |
| InChI | InChI=1S/C47H24F24OP2/c1-39(2)33-5-3-7-35(73(29-13-21(40(48,49)50)9-22(14-29)41(51,52)53)30-15-23(42(54,55)56)10-24(16-30)43(57,58)59)37(33)72-38-34(39)6-4-8-36(38)74(31-17-25(44(60,61)62)11-26(18-31)45(63,64)65)32-19-27(46(66,67)68)12-28(20-32)47(69,70)71/h3-20H,1-2H3 |
| InChIKey | IDKFJAWYYLNKGO-UHFFFAOYSA-N |
| XLogP | 15.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1122.61 |
| LogP ≤ 5 | 15.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|