C15H42Si6 — CID 6421125
1-butyl-1,2,2,3,3,4,4,5,5,6,6-undecamethylhexasilinane (PubChem CID 6421125) has the molecular formula C15H42Si6 and a molecular weight of 391.02 g/mol. Its IUPAC name is 1-butyl-1,2,2,3,3,4,4,5,5,6,6-undecamethylhexasilinane.
| Compound Name | 1-butyl-1,2,2,3,3,4,4,5,5,6,6-undecamethylhexasilinane |
|---|---|
| PubChem CID | 6421125 |
| Molecular Formula | C15H42Si6 |
| Molecular Weight | 391.02 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 1-butyl-1,2,2,3,3,4,4,5,5,6,6-undecamethylhexasilinane |
| SMILES | CCCC[Si]1(C)[Si](C)(C)[Si](C)(C)[Si](C)(C)[Si](C)(C)[Si]1(C)C |
| InChI | InChI=1S/C15H42Si6/c1-13-14-15-21(12)19(8,9)17(4,5)16(2,3)18(6,7)20(21,10)11/h13-15H2,1-12H3 |
| InChIKey | LEWWXUAGWXHSGC-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.02 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|