C10H32O2Si6 — CID 6421143
1,4-dihydroxy-1,2,2,3,3,4,5,5,6,6-decamethylhexasilinane (PubChem CID 6421143) has the molecular formula C10H32O2Si6 and a molecular weight of 352.88 g/mol. Its IUPAC name is 1,4-dihydroxy-1,2,2,3,3,4,5,5,6,6-decamethylhexasilinane.
| Compound Name | 1,4-dihydroxy-1,2,2,3,3,4,5,5,6,6-decamethylhexasilinane |
|---|---|
| PubChem CID | 6421143 |
| Molecular Formula | C10H32O2Si6 |
| Molecular Weight | 352.88 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 1,4-dihydroxy-1,2,2,3,3,4,5,5,6,6-decamethylhexasilinane |
| SMILES | C[Si]1(C)[Si](C)(C)[Si](C)(O)[Si](C)(C)[Si](C)(C)[Si]1(C)O |
| InChI | InChI=1S/C10H32O2Si6/c1-13(2)14(3,4)18(10,12)16(7,8)15(5,6)17(13,9)11/h11-12H,1-10H3 |
| InChIKey | BNCVAOPSZODKJH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.88 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|