C14H39Si6 — CID 6421161
1-Butyl-1,2,2,3,3,4,4,5,5,6-decamethylhexasilinane (PubChem CID 6421161) has the molecular formula C14H39Si6 and a molecular weight of 375.98 g/mol.
| Compound Name | 1-Butyl-1,2,2,3,3,4,4,5,5,6-decamethylhexasilinane |
|---|---|
| PubChem CID | 6421161 |
| Molecular Formula | C14H39Si6 |
| Molecular Weight | 375.98 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | — |
| SMILES | CCCC[Si]1(C)[Si](C)[Si](C)(C)[Si](C)(C)[Si](C)(C)[Si]1(C)C |
| InChI | InChI=1S/C14H39Si6/c1-12-13-14-20(11)15(2)16(3,4)17(5,6)18(7,8)19(20,9)10/h12-14H2,1-11H3 |
| InChIKey | BQDZUQKOIFVHQD-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.98 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|