C13H36Si6 — CID 6421166
1-Butyl-1,2,2,3,3,4,4,5,5-nonamethylhexasilinane (PubChem CID 6421166) has the molecular formula C13H36Si6 and a molecular weight of 360.95 g/mol.
| Compound Name | 1-Butyl-1,2,2,3,3,4,4,5,5-nonamethylhexasilinane |
|---|---|
| PubChem CID | 6421166 |
| Molecular Formula | C13H36Si6 |
| Molecular Weight | 360.95 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | — |
| SMILES | CCCC[Si]1(C)[Si][Si](C)(C)[Si](C)(C)[Si](C)(C)[Si]1(C)C |
| InChI | InChI=1S/C13H36Si6/c1-11-12-13-19(10)14-15(2,3)16(4,5)17(6,7)18(19,8)9/h11-13H2,1-10H3 |
| InChIKey | PISWIQRYEYWWLT-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.95 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|