About 3-[(2,5-dimethylfuran-3-yl)disulfanyl]-2,5-dimethylfuran
3-[(2,5-dimethylfuran-3-yl)disulfanyl]-2,5-dimethylfuran (PubChem CID 642117) has the molecular formula C12H14O2S2
and a molecular weight of 254.38 g/mol. Its IUPAC name is 3-[(2,5-dimethylfuran-3-yl)disulfanyl]-2,5-dimethylfuran.
Molecular Properties
| Compound Name | 3-[(2,5-dimethylfuran-3-yl)disulfanyl]-2,5-dimethylfuran |
| PubChem CID | 642117 |
| Molecular Formula | C12H14O2S2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 3-[(2,5-dimethylfuran-3-yl)disulfanyl]-2,5-dimethylfuran |
| SMILES | Cc1cc(SSc2cc(C)oc2C)c(C)o1 |
| InChI | InChI=1S/C12H14O2S2/c1-7-5-11(9(3)13-7)15-16-12-6-8(2)14-10(12)4/h5-6H,1-4H3 |
| InChIKey | JDWCALSZHJBMIQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2,5-dimethylfuran-3-yl)disulfanyl]-2,5-dimethylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,5-dimethylfuran-3-yl)disulfanyl]-2,5-dimethylfuran?
The IUPAC name of 3-[(2,5-dimethylfuran-3-yl)disulfanyl]-2,5-dimethylfuran (CID 642117) is 3-[(2,5-dimethylfuran-3-yl)disulfanyl]-2,5-dimethylfuran.
What is the SMILES notation for 3-[(2,5-dimethylfuran-3-yl)disulfanyl]-2,5-dimethylfuran?
The canonical SMILES for 3-[(2,5-dimethylfuran-3-yl)disulfanyl]-2,5-dimethylfuran is Cc1cc(SSc2cc(C)oc2C)c(C)o1.
What is the InChIKey of 3-[(2,5-dimethylfuran-3-yl)disulfanyl]-2,5-dimethylfuran?
The InChIKey is JDWCALSZHJBMIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O2S2/c1-7-5-11(9(3)13-7)15-16-12-6-8(2)14-10(12)4/h5-6H,1-4H3.
What are the key properties of 3-[(2,5-dimethylfuran-3-yl)disulfanyl]-2,5-dimethylfuran?
3-[(2,5-dimethylfuran-3-yl)disulfanyl]-2,5-dimethylfuran has a molecular weight of 254.38 g/mol, XLogP of 4.91, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,5-dimethylfuran-3-yl)disulfanyl]-2,5-dimethylfuran is sourced from PubChem (CID 642117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).