C24H54O4Si3 — CID 6421177
trimethylsilyl 3,7,11-trimethyl-2,3-bis(trimethylsilyloxy)dodecanoate (PubChem CID 6421177) has the molecular formula C24H54O4Si3 and a molecular weight of 490.95 g/mol. Its IUPAC name is trimethylsilyl 3,7,11-trimethyl-2,3-bis(trimethylsilyloxy)dodecanoate.
| Compound Name | trimethylsilyl 3,7,11-trimethyl-2,3-bis(trimethylsilyloxy)dodecanoate |
|---|---|
| PubChem CID | 6421177 |
| Molecular Formula | C24H54O4Si3 |
| Molecular Weight | 490.95 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | trimethylsilyl 3,7,11-trimethyl-2,3-bis(trimethylsilyloxy)dodecanoate |
| SMILES | CC(C)CCCC(C)CCCC(C)(O[Si](C)(C)C)C(O[Si](C)(C)C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C24H54O4Si3/c1-20(2)16-14-17-21(3)18-15-19-24(4,28-31(11,12)13)22(26-29(5,6)7)23(25)27-30(8,9)10/h20-22H,14-19H2,1-13H3 |
| InChIKey | MCSKDLWGPHNPIJ-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.95 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|