C11H15Cl3O5 — CID 6421201
2,3,5-trichloro-5-(2,2-dimethoxyethyl)-4,4-dimethoxycyclopent-2-en-1-one (PubChem CID 6421201) has the molecular formula C11H15Cl3O5 and a molecular weight of 333.60 g/mol. Its IUPAC name is 2,3,5-trichloro-5-(2,2-dimethoxyethyl)-4,4-dimethoxycyclopent-2-en-1-one.
| Compound Name | 2,3,5-trichloro-5-(2,2-dimethoxyethyl)-4,4-dimethoxycyclopent-2-en-1-one |
|---|---|
| PubChem CID | 6421201 |
| Molecular Formula | C11H15Cl3O5 |
| Molecular Weight | 333.60 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | 2,3,5-trichloro-5-(2,2-dimethoxyethyl)-4,4-dimethoxycyclopent-2-en-1-one |
| SMILES | COC(CC1(Cl)C(=O)C(Cl)=C(Cl)C1(OC)OC)OC |
| InChI | InChI=1S/C11H15Cl3O5/c1-16-6(17-2)5-10(14)9(15)7(12)8(13)11(10,18-3)19-4/h6H,5H2,1-4H3 |
| InChIKey | QKQDJDYCSACYCV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.60 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|