About 3-fluoro-2,4,5-trimethoxy-6-(methoxymethyl)oxane
3-fluoro-2,4,5-trimethoxy-6-(methoxymethyl)oxane (PubChem CID 6421453) has the molecular formula C10H19FO5
and a molecular weight of 238.25 g/mol. Its IUPAC name is 3-fluoro-2,4,5-trimethoxy-6-(methoxymethyl)oxane.
Molecular Properties
| Compound Name | 3-fluoro-2,4,5-trimethoxy-6-(methoxymethyl)oxane |
| PubChem CID | 6421453 |
| Molecular Formula | C10H19FO5 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 3-fluoro-2,4,5-trimethoxy-6-(methoxymethyl)oxane |
| SMILES | COCC1OC(OC)C(F)C(OC)C1OC |
| InChI | InChI=1S/C10H19FO5/c1-12-5-6-8(13-2)9(14-3)7(11)10(15-4)16-6/h6-10H,5H2,1-4H3 |
| InChIKey | VQYWZTBCIVOBBA-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-fluoro-2,4,5-trimethoxy-6-(methoxymethyl)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-2,4,5-trimethoxy-6-(methoxymethyl)oxane?
The IUPAC name of 3-fluoro-2,4,5-trimethoxy-6-(methoxymethyl)oxane (CID 6421453) is 3-fluoro-2,4,5-trimethoxy-6-(methoxymethyl)oxane.
What is the SMILES notation for 3-fluoro-2,4,5-trimethoxy-6-(methoxymethyl)oxane?
The canonical SMILES for 3-fluoro-2,4,5-trimethoxy-6-(methoxymethyl)oxane is COCC1OC(OC)C(F)C(OC)C1OC.
What is the InChIKey of 3-fluoro-2,4,5-trimethoxy-6-(methoxymethyl)oxane?
The InChIKey is VQYWZTBCIVOBBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19FO5/c1-12-5-6-8(13-2)9(14-3)7(11)10(15-4)16-6/h6-10H,5H2,1-4H3.
What are the key properties of 3-fluoro-2,4,5-trimethoxy-6-(methoxymethyl)oxane?
3-fluoro-2,4,5-trimethoxy-6-(methoxymethyl)oxane has a molecular weight of 238.25 g/mol, XLogP of 0.37, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-2,4,5-trimethoxy-6-(methoxymethyl)oxane is sourced from PubChem (CID 6421453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).