About 4,7-dimethyl-6,7-bis(methylsulfanyl)octan-3-one
4,7-dimethyl-6,7-bis(methylsulfanyl)octan-3-one (PubChem CID 6421486) has the molecular formula C12H24OS2
and a molecular weight of 248.46 g/mol. Its IUPAC name is 4,7-dimethyl-6,7-bis(methylsulfanyl)octan-3-one.
Molecular Properties
| Compound Name | 4,7-dimethyl-6,7-bis(methylsulfanyl)octan-3-one |
| PubChem CID | 6421486 |
| Molecular Formula | C12H24OS2 |
| Molecular Weight | 248.46 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 4,7-dimethyl-6,7-bis(methylsulfanyl)octan-3-one |
| SMILES | CCC(=O)C(C)CC(SC)C(C)(C)SC |
| InChI | InChI=1S/C12H24OS2/c1-7-10(13)9(2)8-11(14-5)12(3,4)15-6/h9,11H,7-8H2,1-6H3 |
| InChIKey | BZWCVKVDSSVTKW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,7-dimethyl-6,7-bis(methylsulfanyl)octan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dimethyl-6,7-bis(methylsulfanyl)octan-3-one?
The IUPAC name of 4,7-dimethyl-6,7-bis(methylsulfanyl)octan-3-one (CID 6421486) is 4,7-dimethyl-6,7-bis(methylsulfanyl)octan-3-one.
What is the SMILES notation for 4,7-dimethyl-6,7-bis(methylsulfanyl)octan-3-one?
The canonical SMILES for 4,7-dimethyl-6,7-bis(methylsulfanyl)octan-3-one is CCC(=O)C(C)CC(SC)C(C)(C)SC.
What is the InChIKey of 4,7-dimethyl-6,7-bis(methylsulfanyl)octan-3-one?
The InChIKey is BZWCVKVDSSVTKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24OS2/c1-7-10(13)9(2)8-11(14-5)12(3,4)15-6/h9,11H,7-8H2,1-6H3.
What are the key properties of 4,7-dimethyl-6,7-bis(methylsulfanyl)octan-3-one?
4,7-dimethyl-6,7-bis(methylsulfanyl)octan-3-one has a molecular weight of 248.46 g/mol, XLogP of 3.86, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dimethyl-6,7-bis(methylsulfanyl)octan-3-one is sourced from PubChem (CID 6421486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).