C13H9F5N2O2 — CID 6421686
(2,3,4,5,6-pentafluorophenyl)methyl 2-(1-methylimidazol-4-yl)acetate (PubChem CID 6421686) has the molecular formula C13H9F5N2O2 and a molecular weight of 320.22 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)methyl 2-(1-methylimidazol-4-yl)acetate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)methyl 2-(1-methylimidazol-4-yl)acetate |
|---|---|
| PubChem CID | 6421686 |
| Molecular Formula | C13H9F5N2O2 |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)methyl 2-(1-methylimidazol-4-yl)acetate |
| SMILES | Cn1cnc(CC(=O)OCc2c(F)c(F)c(F)c(F)c2F)c1 |
| InChI | InChI=1S/C13H9F5N2O2/c1-20-3-6(19-5-20)2-8(21)22-4-7-9(14)11(16)13(18)12(17)10(7)15/h3,5H,2,4H2,1H3 |
| InChIKey | LIOQZHJIGGIVKG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|