About 2-(2-methyl-1,3-dithiolan-2-yl)-1-phenylethanone
2-(2-methyl-1,3-dithiolan-2-yl)-1-phenylethanone (PubChem CID 6421990) has the molecular formula C12H14OS2
and a molecular weight of 238.38 g/mol. Its IUPAC name is 2-(2-methyl-1,3-dithiolan-2-yl)-1-phenylethanone.
Molecular Properties
| Compound Name | 2-(2-methyl-1,3-dithiolan-2-yl)-1-phenylethanone |
| PubChem CID | 6421990 |
| Molecular Formula | C12H14OS2 |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 2-(2-methyl-1,3-dithiolan-2-yl)-1-phenylethanone |
| SMILES | CC1(CC(=O)c2ccccc2)SCCS1 |
| InChI | InChI=1S/C12H14OS2/c1-12(14-7-8-15-12)9-11(13)10-5-3-2-4-6-10/h2-6H,7-9H2,1H3 |
| InChIKey | XIDQUTSKKIKAMK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-methyl-1,3-dithiolan-2-yl)-1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methyl-1,3-dithiolan-2-yl)-1-phenylethanone?
The IUPAC name of 2-(2-methyl-1,3-dithiolan-2-yl)-1-phenylethanone (CID 6421990) is 2-(2-methyl-1,3-dithiolan-2-yl)-1-phenylethanone.
What is the SMILES notation for 2-(2-methyl-1,3-dithiolan-2-yl)-1-phenylethanone?
The canonical SMILES for 2-(2-methyl-1,3-dithiolan-2-yl)-1-phenylethanone is CC1(CC(=O)c2ccccc2)SCCS1.
What is the InChIKey of 2-(2-methyl-1,3-dithiolan-2-yl)-1-phenylethanone?
The InChIKey is XIDQUTSKKIKAMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14OS2/c1-12(14-7-8-15-12)9-11(13)10-5-3-2-4-6-10/h2-6H,7-9H2,1H3.
What are the key properties of 2-(2-methyl-1,3-dithiolan-2-yl)-1-phenylethanone?
2-(2-methyl-1,3-dithiolan-2-yl)-1-phenylethanone has a molecular weight of 238.38 g/mol, XLogP of 3.46, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methyl-1,3-dithiolan-2-yl)-1-phenylethanone is sourced from PubChem (CID 6421990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).