C19H19N3OS — CID 6421993
7,10-diphenyl-6-oxa-8,10,11-triazaspiro[4.6]undec-7-ene-9-thione (PubChem CID 6421993) has the molecular formula C19H19N3OS and a molecular weight of 337.45 g/mol. Its IUPAC name is 7,10-diphenyl-6-oxa-8,10,11-triazaspiro[4.6]undec-7-ene-9-thione.
| Compound Name | 7,10-diphenyl-6-oxa-8,10,11-triazaspiro[4.6]undec-7-ene-9-thione |
|---|---|
| PubChem CID | 6421993 |
| Molecular Formula | C19H19N3OS |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 7,10-diphenyl-6-oxa-8,10,11-triazaspiro[4.6]undec-7-ene-9-thione |
| SMILES | S=C1N=C(c2ccccc2)OC2(CCCC2)NN1c1ccccc1 |
| InChI | InChI=1S/C19H19N3OS/c24-18-20-17(15-9-3-1-4-10-15)23-19(13-7-8-14-19)21-22(18)16-11-5-2-6-12-16/h1-6,9-12,21H,7-8,13-14H2 |
| InChIKey | OITYEHMSAMKSDU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|