About 1-benzylpyrazol-4-ol
1-benzylpyrazol-4-ol (PubChem CID 642218) has the molecular formula C10H10N2O
and a molecular weight of 174.20 g/mol. Its IUPAC name is 1-benzylpyrazol-4-ol.
Molecular Properties
| Compound Name | 1-benzylpyrazol-4-ol |
| PubChem CID | 642218 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 1-benzylpyrazol-4-ol |
| SMILES | Oc1cnn(Cc2ccccc2)c1 |
| InChI | InChI=1S/C10H10N2O/c13-10-6-11-12(8-10)7-9-4-2-1-3-5-9/h1-6,8,13H,7H2 |
| InChIKey | BELUNASLYMZLPW-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-benzylpyrazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzylpyrazol-4-ol?
The IUPAC name of 1-benzylpyrazol-4-ol (CID 642218) is 1-benzylpyrazol-4-ol.
What is the SMILES notation for 1-benzylpyrazol-4-ol?
The canonical SMILES for 1-benzylpyrazol-4-ol is Oc1cnn(Cc2ccccc2)c1.
What is the InChIKey of 1-benzylpyrazol-4-ol?
The InChIKey is BELUNASLYMZLPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O/c13-10-6-11-12(8-10)7-9-4-2-1-3-5-9/h1-6,8,13H,7H2.
What are the key properties of 1-benzylpyrazol-4-ol?
1-benzylpyrazol-4-ol has a molecular weight of 174.20 g/mol, XLogP of 1.64, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzylpyrazol-4-ol is sourced from PubChem (CID 642218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).