C14H28N2O — CID 6422216
4-(1,2,2,6,6-pentamethylpiperidin-4-yl)morpholine (PubChem CID 6422216) has the molecular formula C14H28N2O and a molecular weight of 240.39 g/mol. Its IUPAC name is 4-(1,2,2,6,6-pentamethylpiperidin-4-yl)morpholine.
| Compound Name | 4-(1,2,2,6,6-pentamethylpiperidin-4-yl)morpholine |
|---|---|
| PubChem CID | 6422216 |
| Molecular Formula | C14H28N2O |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.22 |
| IUPAC Name | 4-(1,2,2,6,6-pentamethylpiperidin-4-yl)morpholine |
| SMILES | CN1C(C)(C)CC(N2CCOCC2)CC1(C)C |
| InChI | InChI=1S/C14H28N2O/c1-13(2)10-12(11-14(3,4)15(13)5)16-6-8-17-9-7-16/h12H,6-11H2,1-5H3 |
| InChIKey | ISMUSYLVBLHKFA-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |