About 5-ethoxy-1,3-dimethylpyrazole
5-ethoxy-1,3-dimethylpyrazole (PubChem CID 6422219) has the molecular formula C7H12N2O
and a molecular weight of 140.19 g/mol. Its IUPAC name is 5-ethoxy-1,3-dimethylpyrazole.
Molecular Properties
| Compound Name | 5-ethoxy-1,3-dimethylpyrazole |
| PubChem CID | 6422219 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 5-ethoxy-1,3-dimethylpyrazole |
| SMILES | CCOc1cc(C)nn1C |
| InChI | InChI=1S/C7H12N2O/c1-4-10-7-5-6(2)8-9(7)3/h5H,4H2,1-3H3 |
| InChIKey | ULDYZKNULMCCIL-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-ethoxy-1,3-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethoxy-1,3-dimethylpyrazole?
The IUPAC name of 5-ethoxy-1,3-dimethylpyrazole (CID 6422219) is 5-ethoxy-1,3-dimethylpyrazole.
What is the SMILES notation for 5-ethoxy-1,3-dimethylpyrazole?
The canonical SMILES for 5-ethoxy-1,3-dimethylpyrazole is CCOc1cc(C)nn1C.
What is the InChIKey of 5-ethoxy-1,3-dimethylpyrazole?
The InChIKey is ULDYZKNULMCCIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O/c1-4-10-7-5-6(2)8-9(7)3/h5H,4H2,1-3H3.
What are the key properties of 5-ethoxy-1,3-dimethylpyrazole?
5-ethoxy-1,3-dimethylpyrazole has a molecular weight of 140.19 g/mol, XLogP of 1.13, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxy-1,3-dimethylpyrazole is sourced from PubChem (CID 6422219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).