About 5-methylthiophen-3-amine
5-methylthiophen-3-amine (PubChem CID 6422232) has the molecular formula C5H7NS
and a molecular weight of 113.18 g/mol. Its IUPAC name is 5-methylthiophen-3-amine.
Molecular Properties
| Compound Name | 5-methylthiophen-3-amine |
| PubChem CID | 6422232 |
| Molecular Formula | C5H7NS |
| Molecular Weight | 113.18 g/mol |
| Exact Mass | 113.03 |
| IUPAC Name | 5-methylthiophen-3-amine |
| SMILES | Cc1cc(N)cs1 |
| InChI | InChI=1S/C5H7NS/c1-4-2-5(6)3-7-4/h2-3H,6H2,1H3 |
| InChIKey | YHGSDEFWAXHCDW-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.18 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methylthiophen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylthiophen-3-amine?
The IUPAC name of 5-methylthiophen-3-amine (CID 6422232) is 5-methylthiophen-3-amine.
What is the SMILES notation for 5-methylthiophen-3-amine?
The canonical SMILES for 5-methylthiophen-3-amine is Cc1cc(N)cs1.
What is the InChIKey of 5-methylthiophen-3-amine?
The InChIKey is YHGSDEFWAXHCDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NS/c1-4-2-5(6)3-7-4/h2-3H,6H2,1H3.
What are the key properties of 5-methylthiophen-3-amine?
5-methylthiophen-3-amine has a molecular weight of 113.18 g/mol, XLogP of 1.64, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylthiophen-3-amine is sourced from PubChem (CID 6422232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).