C10H30F2OSi6 — CID 6422325
3,6-difluoro-2,2,3,4,4,5,5,6,7,7-decamethyloxahexasilepane (PubChem CID 6422325) has the molecular formula C10H30F2OSi6 and a molecular weight of 372.86 g/mol. Its IUPAC name is 3,6-difluoro-2,2,3,4,4,5,5,6,7,7-decamethyloxahexasilepane.
| Compound Name | 3,6-difluoro-2,2,3,4,4,5,5,6,7,7-decamethyloxahexasilepane |
|---|---|
| PubChem CID | 6422325 |
| Molecular Formula | C10H30F2OSi6 |
| Molecular Weight | 372.86 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 3,6-difluoro-2,2,3,4,4,5,5,6,7,7-decamethyloxahexasilepane |
| SMILES | C[Si]1(C)O[Si](C)(C)[Si](C)(F)[Si](C)(C)[Si](C)(C)[Si]1(C)F |
| InChI | InChI=1S/C10H30F2OSi6/c1-14(2)13-15(3,4)19(10,12)17(7,8)16(5,6)18(14,9)11/h1-10H3 |
| InChIKey | QDPGBULEFJCJQL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.86 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|