About 4-aminooxybenzonitrile
4-aminooxybenzonitrile (PubChem CID 6422401) has the molecular formula C7H6N2O
and a molecular weight of 134.14 g/mol. Its IUPAC name is 4-aminooxybenzonitrile.
Molecular Properties
| Compound Name | 4-aminooxybenzonitrile |
| PubChem CID | 6422401 |
| Molecular Formula | C7H6N2O |
| Molecular Weight | 134.14 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | 4-aminooxybenzonitrile |
| SMILES | N#Cc1ccc(ON)cc1 |
| InChI | InChI=1S/C7H6N2O/c8-5-6-1-3-7(10-9)4-2-6/h1-4H,9H2 |
| InChIKey | KJYWSKLWGHSQEP-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.14 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-aminooxybenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminooxybenzonitrile?
The IUPAC name of 4-aminooxybenzonitrile (CID 6422401) is 4-aminooxybenzonitrile.
What is the SMILES notation for 4-aminooxybenzonitrile?
The canonical SMILES for 4-aminooxybenzonitrile is N#Cc1ccc(ON)cc1.
What is the InChIKey of 4-aminooxybenzonitrile?
The InChIKey is KJYWSKLWGHSQEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O/c8-5-6-1-3-7(10-9)4-2-6/h1-4H,9H2.
What are the key properties of 4-aminooxybenzonitrile?
4-aminooxybenzonitrile has a molecular weight of 134.14 g/mol, XLogP of 0.81, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminooxybenzonitrile is sourced from PubChem (CID 6422401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).