About (2,5-dioxopyrrolidin-1-yl) 4-methylbenzoate
(2,5-dioxopyrrolidin-1-yl) 4-methylbenzoate (PubChem CID 6422404) has the molecular formula C12H11NO4
and a molecular weight of 233.22 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-methylbenzoate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-methylbenzoate |
| PubChem CID | 6422404 |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)ON2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C12H11NO4/c1-8-2-4-9(5-3-8)12(16)17-13-10(14)6-7-11(13)15/h2-5H,6-7H2,1H3 |
| InChIKey | STJGCFDYPNABQG-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrolidin-1-yl) 4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl) 4-methylbenzoate?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl) 4-methylbenzoate (CID 6422404) is (2,5-dioxopyrrolidin-1-yl) 4-methylbenzoate.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl) 4-methylbenzoate?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl) 4-methylbenzoate is Cc1ccc(C(=O)ON2C(=O)CCC2=O)cc1.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) 4-methylbenzoate?
The InChIKey is STJGCFDYPNABQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO4/c1-8-2-4-9(5-3-8)12(16)17-13-10(14)6-7-11(13)15/h2-5H,6-7H2,1H3.
What are the key properties of (2,5-dioxopyrrolidin-1-yl) 4-methylbenzoate?
(2,5-dioxopyrrolidin-1-yl) 4-methylbenzoate has a molecular weight of 233.22 g/mol, XLogP of 1.22, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl) 4-methylbenzoate is sourced from PubChem (CID 6422404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).