About methyl 5-methylhex-5-enoate
methyl 5-methylhex-5-enoate (PubChem CID 642298) has the molecular formula C8H14O2
and a molecular weight of 142.20 g/mol. Its IUPAC name is methyl 5-methylhex-5-enoate.
Molecular Properties
| Compound Name | methyl 5-methylhex-5-enoate |
| PubChem CID | 642298 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | methyl 5-methylhex-5-enoate |
| SMILES | C=C(C)CCCC(=O)OC |
| InChI | InChI=1S/C8H14O2/c1-7(2)5-4-6-8(9)10-3/h1,4-6H2,2-3H3 |
| InChIKey | XUUOSBRRQHFVNM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-methylhex-5-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-methylhex-5-enoate?
The IUPAC name of methyl 5-methylhex-5-enoate (CID 642298) is methyl 5-methylhex-5-enoate.
What is the SMILES notation for methyl 5-methylhex-5-enoate?
The canonical SMILES for methyl 5-methylhex-5-enoate is C=C(C)CCCC(=O)OC.
What is the InChIKey of methyl 5-methylhex-5-enoate?
The InChIKey is XUUOSBRRQHFVNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2/c1-7(2)5-4-6-8(9)10-3/h1,4-6H2,2-3H3.
What are the key properties of methyl 5-methylhex-5-enoate?
methyl 5-methylhex-5-enoate has a molecular weight of 142.20 g/mol, XLogP of 1.91, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-methylhex-5-enoate is sourced from PubChem (CID 642298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).