C15H24O3 — CID 6423119
ethyl 2-(4-hydroxy-2,6-dimethylhepta-1,6-dien-4-yl)cyclopropane-1-carboxylate (PubChem CID 6423119) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is ethyl 2-(4-hydroxy-2,6-dimethylhepta-1,6-dien-4-yl)cyclopropane-1-carboxylate.
| Compound Name | ethyl 2-(4-hydroxy-2,6-dimethylhepta-1,6-dien-4-yl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 6423119 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | ethyl 2-(4-hydroxy-2,6-dimethylhepta-1,6-dien-4-yl)cyclopropane-1-carboxylate |
| SMILES | C=C(C)CC(O)(CC(=C)C)C1CC1C(=O)OCC |
| InChI | InChI=1S/C15H24O3/c1-6-18-14(16)12-7-13(12)15(17,8-10(2)3)9-11(4)5/h12-13,17H,2,4,6-9H2,1,3,5H3 |
| InChIKey | BDYZFQLVFSDKHW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|