C8H8N2O — CID 6423312
7-amino-1,3-dihydroindol-2-one (PubChem CID 6423312) has the molecular formula C8H8N2O and a molecular weight of 148.16 g/mol. Its IUPAC name is 7-amino-1,3-dihydroindol-2-one.
| Compound Name | 7-amino-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 6423312 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 7-amino-1,3-dihydroindol-2-one |
| SMILES | Nc1cccc2c1NC(=O)C2 |
| InChI | InChI=1S/C8H8N2O/c9-6-3-1-2-5-4-7(11)10-8(5)6/h1-3H,4,9H2,(H,10,11) |
| InChIKey | RKPBTSNUXKVZPG-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|