C23H30O4 — CID 6423772
2-O-[2-(1-adamantyl)ethyl] 1-O-propyl benzene-1,2-dicarboxylate (PubChem CID 6423772) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is 2-O-[2-(1-adamantyl)ethyl] 1-O-propyl benzene-1,2-dicarboxylate.
| Compound Name | 2-O-[2-(1-adamantyl)ethyl] 1-O-propyl benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 6423772 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 2-O-[2-(1-adamantyl)ethyl] 1-O-propyl benzene-1,2-dicarboxylate |
| SMILES | CCCOC(=O)c1ccccc1C(=O)OCCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H30O4/c1-2-8-26-21(24)19-5-3-4-6-20(19)22(25)27-9-7-23-13-16-10-17(14-23)12-18(11-16)15-23/h3-6,16-18H,2,7-15H2,1H3 |
| InChIKey | OYXCZHXTUFZACM-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |