About (2Z)-2-benzylidene-4,6-dimethoxy-1-benzofuran-3-one
(2Z)-2-benzylidene-4,6-dimethoxy-1-benzofuran-3-one (PubChem CID 642387) has the molecular formula C17H14O4
and a molecular weight of 282.30 g/mol. Its IUPAC name is (2Z)-2-benzylidene-4,6-dimethoxy-1-benzofuran-3-one.
Molecular Properties
| Compound Name | (2Z)-2-benzylidene-4,6-dimethoxy-1-benzofuran-3-one |
| PubChem CID | 642387 |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | (2Z)-2-benzylidene-4,6-dimethoxy-1-benzofuran-3-one |
| SMILES | COc1cc(OC)c2c(c1)O/C(=C\c1ccccc1)C2=O |
| InChI | InChI=1S/C17H14O4/c1-19-12-9-13(20-2)16-14(10-12)21-15(17(16)18)8-11-6-4-3-5-7-11/h3-10H,1-2H3/b15-8- |
| InChIKey | URJIGAYOIPBIDO-NVNXTCNLSA-N |
| XLogP | 3.32 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-benzylidene-4,6-dimethoxy-1-benzofuran-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-benzylidene-4,6-dimethoxy-1-benzofuran-3-one?
The IUPAC name of (2Z)-2-benzylidene-4,6-dimethoxy-1-benzofuran-3-one (CID 642387) is (2Z)-2-benzylidene-4,6-dimethoxy-1-benzofuran-3-one.
What is the SMILES notation for (2Z)-2-benzylidene-4,6-dimethoxy-1-benzofuran-3-one?
The canonical SMILES for (2Z)-2-benzylidene-4,6-dimethoxy-1-benzofuran-3-one is COc1cc(OC)c2c(c1)O/C(=C\c1ccccc1)C2=O.
What is the InChIKey of (2Z)-2-benzylidene-4,6-dimethoxy-1-benzofuran-3-one?
The InChIKey is URJIGAYOIPBIDO-NVNXTCNLSA-N. The full InChI is InChI=1S/C17H14O4/c1-19-12-9-13(20-2)16-14(10-12)21-15(17(16)18)8-11-6-4-3-5-7-11/h3-10H,1-2H3/b15-8-.
What are the key properties of (2Z)-2-benzylidene-4,6-dimethoxy-1-benzofuran-3-one?
(2Z)-2-benzylidene-4,6-dimethoxy-1-benzofuran-3-one has a molecular weight of 282.30 g/mol, XLogP of 3.32, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-benzylidene-4,6-dimethoxy-1-benzofuran-3-one is sourced from PubChem (CID 642387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).