About bis(6-ethyloctan-3-yl) benzene-1,2-dicarboxylate
bis(6-ethyloctan-3-yl) benzene-1,2-dicarboxylate (PubChem CID 6424146) has the molecular formula C28H46O4
and a molecular weight of 446.67 g/mol. Its IUPAC name is bis(6-ethyloctan-3-yl) benzene-1,2-dicarboxylate.
Molecular Properties
| Compound Name | bis(6-ethyloctan-3-yl) benzene-1,2-dicarboxylate |
| PubChem CID | 6424146 |
| Molecular Formula | C28H46O4 |
| Molecular Weight | 446.67 g/mol |
| Exact Mass | 446.34 |
| IUPAC Name | bis(6-ethyloctan-3-yl) benzene-1,2-dicarboxylate |
| SMILES | CCC(CC)CCC(CC)OC(=O)c1ccccc1C(=O)OC(CC)CCC(CC)CC |
| InChI | InChI=1S/C28H46O4/c1-7-21(8-2)17-19-23(11-5)31-27(29)25-15-13-14-16-26(25)28(30)32-24(12-6)20-18-22(9-3)10-4/h13-16,21-24H,7-12,17-20H2,1-6H3 |
| InChIKey | XVYNMOMKXGFINE-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.67 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(6-ethyloctan-3-yl) benzene-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(6-ethyloctan-3-yl) benzene-1,2-dicarboxylate?
The IUPAC name of bis(6-ethyloctan-3-yl) benzene-1,2-dicarboxylate (CID 6424146) is bis(6-ethyloctan-3-yl) benzene-1,2-dicarboxylate.
What is the SMILES notation for bis(6-ethyloctan-3-yl) benzene-1,2-dicarboxylate?
The canonical SMILES for bis(6-ethyloctan-3-yl) benzene-1,2-dicarboxylate is CCC(CC)CCC(CC)OC(=O)c1ccccc1C(=O)OC(CC)CCC(CC)CC.
What is the InChIKey of bis(6-ethyloctan-3-yl) benzene-1,2-dicarboxylate?
The InChIKey is XVYNMOMKXGFINE-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H46O4/c1-7-21(8-2)17-19-23(11-5)31-27(29)25-15-13-14-16-26(25)28(30)32-24(12-6)20-18-22(9-3)10-4/h13-16,21-24H,7-12,17-20H2,1-6H3.
What are the key properties of bis(6-ethyloctan-3-yl) benzene-1,2-dicarboxylate?
bis(6-ethyloctan-3-yl) benzene-1,2-dicarboxylate has a molecular weight of 446.67 g/mol, XLogP of 7.99, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(6-ethyloctan-3-yl) benzene-1,2-dicarboxylate is sourced from PubChem (CID 6424146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).