About 4,5-dihydro-1,2-oxazole-3-carboxylic acid
4,5-dihydro-1,2-oxazole-3-carboxylic acid (PubChem CID 642418) has the molecular formula C4H5NO3
and a molecular weight of 115.09 g/mol. Its IUPAC name is 4,5-dihydro-1,2-oxazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 4,5-dihydro-1,2-oxazole-3-carboxylic acid |
| PubChem CID | 642418 |
| Molecular Formula | C4H5NO3 |
| Molecular Weight | 115.09 g/mol |
| Exact Mass | 115.03 |
| IUPAC Name | 4,5-dihydro-1,2-oxazole-3-carboxylic acid |
| SMILES | O=C(O)C1=NOCC1 |
| InChI | InChI=1S/C4H5NO3/c6-4(7)3-1-2-8-5-3/h1-2H2,(H,6,7) |
| InChIKey | ZYDBNGULYNHMSF-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.09 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-dihydro-1,2-oxazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydro-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 4,5-dihydro-1,2-oxazole-3-carboxylic acid (CID 642418) is 4,5-dihydro-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 4,5-dihydro-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 4,5-dihydro-1,2-oxazole-3-carboxylic acid is O=C(O)C1=NOCC1.
What is the InChIKey of 4,5-dihydro-1,2-oxazole-3-carboxylic acid?
The InChIKey is ZYDBNGULYNHMSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO3/c6-4(7)3-1-2-8-5-3/h1-2H2,(H,6,7).
What are the key properties of 4,5-dihydro-1,2-oxazole-3-carboxylic acid?
4,5-dihydro-1,2-oxazole-3-carboxylic acid has a molecular weight of 115.09 g/mol, XLogP of -0.15, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydro-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 642418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).