About undec-10-enyl 2-(ethoxycarbonylamino)-4-methylpentanoate
undec-10-enyl 2-(ethoxycarbonylamino)-4-methylpentanoate (PubChem CID 6424358) has the molecular formula C20H37NO4
and a molecular weight of 355.52 g/mol. Its IUPAC name is undec-10-enyl 2-(ethoxycarbonylamino)-4-methylpentanoate.
Molecular Properties
| Compound Name | undec-10-enyl 2-(ethoxycarbonylamino)-4-methylpentanoate |
| PubChem CID | 6424358 |
| Molecular Formula | C20H37NO4 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.27 |
| IUPAC Name | undec-10-enyl 2-(ethoxycarbonylamino)-4-methylpentanoate |
| SMILES | C=CCCCCCCCCCOC(=O)C(CC(C)C)NC(=O)OCC |
| InChI | InChI=1S/C20H37NO4/c1-5-7-8-9-10-11-12-13-14-15-25-19(22)18(16-17(3)4)21-20(23)24-6-2/h5,17-18H,1,6-16H2,2-4H3,(H,21,23) |
| InChIKey | XQDOYXGNAZXWLG-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze undec-10-enyl 2-(ethoxycarbonylamino)-4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of undec-10-enyl 2-(ethoxycarbonylamino)-4-methylpentanoate?
The IUPAC name of undec-10-enyl 2-(ethoxycarbonylamino)-4-methylpentanoate (CID 6424358) is undec-10-enyl 2-(ethoxycarbonylamino)-4-methylpentanoate.
What is the SMILES notation for undec-10-enyl 2-(ethoxycarbonylamino)-4-methylpentanoate?
The canonical SMILES for undec-10-enyl 2-(ethoxycarbonylamino)-4-methylpentanoate is C=CCCCCCCCCCOC(=O)C(CC(C)C)NC(=O)OCC.
What is the InChIKey of undec-10-enyl 2-(ethoxycarbonylamino)-4-methylpentanoate?
The InChIKey is XQDOYXGNAZXWLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H37NO4/c1-5-7-8-9-10-11-12-13-14-15-25-19(22)18(16-17(3)4)21-20(23)24-6-2/h5,17-18H,1,6-16H2,2-4H3,(H,21,23).
What are the key properties of undec-10-enyl 2-(ethoxycarbonylamino)-4-methylpentanoate?
undec-10-enyl 2-(ethoxycarbonylamino)-4-methylpentanoate has a molecular weight of 355.52 g/mol, XLogP of 5.00, 15 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for undec-10-enyl 2-(ethoxycarbonylamino)-4-methylpentanoate is sourced from PubChem (CID 6424358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).