About 1-[ethyl(2,2,2-trifluoroethyl)phosphoryl]oxy-2-methylpropane
1-[ethyl(2,2,2-trifluoroethyl)phosphoryl]oxy-2-methylpropane (PubChem CID 6424811) has the molecular formula C8H16F3O2P
and a molecular weight of 232.18 g/mol. Its IUPAC name is 1-[ethyl(2,2,2-trifluoroethyl)phosphoryl]oxy-2-methylpropane.
Molecular Properties
| Compound Name | 1-[ethyl(2,2,2-trifluoroethyl)phosphoryl]oxy-2-methylpropane |
| PubChem CID | 6424811 |
| Molecular Formula | C8H16F3O2P |
| Molecular Weight | 232.18 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 1-[ethyl(2,2,2-trifluoroethyl)phosphoryl]oxy-2-methylpropane |
| SMILES | CCP(=O)(CC(F)(F)F)OCC(C)C |
| InChI | InChI=1S/C8H16F3O2P/c1-4-14(12,6-8(9,10)11)13-5-7(2)3/h7H,4-6H2,1-3H3 |
| InChIKey | MSUPJGWZFWOHEI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.18 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-[ethyl(2,2,2-trifluoroethyl)phosphoryl]oxy-2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[ethyl(2,2,2-trifluoroethyl)phosphoryl]oxy-2-methylpropane?
The IUPAC name of 1-[ethyl(2,2,2-trifluoroethyl)phosphoryl]oxy-2-methylpropane (CID 6424811) is 1-[ethyl(2,2,2-trifluoroethyl)phosphoryl]oxy-2-methylpropane.
What is the SMILES notation for 1-[ethyl(2,2,2-trifluoroethyl)phosphoryl]oxy-2-methylpropane?
The canonical SMILES for 1-[ethyl(2,2,2-trifluoroethyl)phosphoryl]oxy-2-methylpropane is CCP(=O)(CC(F)(F)F)OCC(C)C.
What is the InChIKey of 1-[ethyl(2,2,2-trifluoroethyl)phosphoryl]oxy-2-methylpropane?
The InChIKey is MSUPJGWZFWOHEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16F3O2P/c1-4-14(12,6-8(9,10)11)13-5-7(2)3/h7H,4-6H2,1-3H3.
What are the key properties of 1-[ethyl(2,2,2-trifluoroethyl)phosphoryl]oxy-2-methylpropane?
1-[ethyl(2,2,2-trifluoroethyl)phosphoryl]oxy-2-methylpropane has a molecular weight of 232.18 g/mol, XLogP of 3.52, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[ethyl(2,2,2-trifluoroethyl)phosphoryl]oxy-2-methylpropane is sourced from PubChem (CID 6424811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).