C9H10N2O2 — CID 6424833
7-nitro-1,2,3,4-tetrahydroisoquinoline (PubChem CID 6424833) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is 7-nitro-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 7-nitro-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 6424833 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 7-nitro-1,2,3,4-tetrahydroisoquinoline |
| SMILES | O=[N+]([O-])c1ccc2c(c1)CNCC2 |
| InChI | InChI=1S/C9H10N2O2/c12-11(13)9-2-1-7-3-4-10-6-8(7)5-9/h1-2,5,10H,3-4,6H2 |
| InChIKey | YPRWYZSUBZXORL-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|